C17H20N2O9 — CID 102401432
2-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]acetohydrazide (PubChem CID 102401432) has the molecular formula C17H20N2O9 and a molecular weight of 396.35 g/mol. Its IUPAC name is 2-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]acetohydrazide.
| Compound Name | 2-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 102401432 |
| Molecular Formula | C17H20N2O9 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]acetohydrazide |
| SMILES | NNC(=O)Cc1cc(=O)oc2cc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C17H20N2O9/c18-19-12(21)3-7-4-13(22)27-10-5-8(1-2-9(7)10)26-17-16(25)15(24)14(23)11(6-20)28-17/h1-2,4-5,11,14-17,20,23-25H,3,6,18H2,(H,19,21)/t11-,14+,15+,16-,17-/m1/s1 |
| InChIKey | OINLTTMSRWFOSB-RDZAWVCESA-N |
| XLogP | -2.50 |
| TPSA | 184.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|