C20H23NO12 — CID 57123729
4-amino-3-methoxy-4-oxo-3-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]butanoic acid (PubChem CID 57123729) has the molecular formula C20H23NO12 and a molecular weight of 469.40 g/mol. Its IUPAC name is 4-amino-3-methoxy-4-oxo-3-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]butanoic acid.
| Compound Name | 4-amino-3-methoxy-4-oxo-3-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]butanoic acid |
|---|---|
| PubChem CID | 57123729 |
| Molecular Formula | C20H23NO12 |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 4-amino-3-methoxy-4-oxo-3-[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]butanoic acid |
| SMILES | COC(CC(=O)O)(C(N)=O)c1cc(=O)oc2cc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C20H23NO12/c1-30-20(19(21)29,6-13(23)24)10-5-14(25)32-11-4-8(2-3-9(10)11)31-18-17(28)16(27)15(26)12(7-22)33-18/h2-5,12,15-18,22,26-28H,6-7H2,1H3,(H2,21,29)(H,23,24)/t12-,15+,16+,17-,18-,20?/m1/s1 |
| InChIKey | XLOJUKNDVWXDHF-KRPVKBITSA-N |
| XLogP | -2.23 |
| TPSA | 219.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|