C17H19NO11 — CID 57200737
2-[[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]oxyamino]acetic acid (PubChem CID 57200737) has the molecular formula C17H19NO11 and a molecular weight of 413.34 g/mol. Its IUPAC name is 2-[[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]oxyamino]acetic acid.
| Compound Name | 2-[[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]oxyamino]acetic acid |
|---|---|
| PubChem CID | 57200737 |
| Molecular Formula | C17H19NO11 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-[[2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-yl]oxyamino]acetic acid |
| SMILES | O=C(O)CNOc1cc(=O)oc2cc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C17H19NO11/c19-6-11-14(23)15(24)16(25)17(28-11)26-7-1-2-8-9(3-7)27-13(22)4-10(8)29-18-5-12(20)21/h1-4,11,14-19,23-25H,5-6H2,(H,20,21)/t11-,14+,15+,16-,17-/m1/s1 |
| InChIKey | LBDZVQPZZSODNR-RDZAWVCESA-N |
| XLogP | -2.06 |
| TPSA | 188.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|