C17H19NO9 — CID 118297625
7-methoxy-2-oxo-N-[(3S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]chromene-3-carboxamide (PubChem CID 118297625) has the molecular formula C17H19NO9 and a molecular weight of 381.34 g/mol. Its IUPAC name is 7-methoxy-2-oxo-N-[(3S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]chromene-3-carboxamide.
| Compound Name | 7-methoxy-2-oxo-N-[(3S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 118297625 |
| Molecular Formula | C17H19NO9 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 7-methoxy-2-oxo-N-[(3S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]chromene-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)N[C@@H]3C(O)OC(CO)[C@@H](O)C3O)c(=O)oc2c1 |
| InChI | InChI=1S/C17H19NO9/c1-25-8-3-2-7-4-9(16(23)26-10(7)5-8)15(22)18-12-14(21)13(20)11(6-19)27-17(12)24/h2-5,11-14,17,19-21,24H,6H2,1H3,(H,18,22)/t11?,12-,13+,14?,17?/m0/s1 |
| InChIKey | SWTWUYFLJOTPEH-AVPXTBEDSA-N |
| XLogP | -1.67 |
| TPSA | 158.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|