C23H24Cl2N2O7 — CID 145201618
1-[(3,4-dichlorophenyl)methyl]-6-methoxy-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]indole-3-carboxamide (PubChem CID 145201618) has the molecular formula C23H24Cl2N2O7 and a molecular weight of 511.36 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-6-methoxy-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]indole-3-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-6-methoxy-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 145201618 |
| Molecular Formula | C23H24Cl2N2O7 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-6-methoxy-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]indole-3-carboxamide |
| SMILES | COc1ccc2c(C(=O)N[C@H]3C(O)O[C@H](CO)[C@@H](O)[C@@H]3O)cn(Cc3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C23H24Cl2N2O7/c1-33-12-3-4-13-14(22(31)26-19-21(30)20(29)18(10-28)34-23(19)32)9-27(17(13)7-12)8-11-2-5-15(24)16(25)6-11/h2-7,9,18-21,23,28-30,32H,8,10H2,1H3,(H,26,31)/t18-,19-,20-,21-,23?/m1/s1 |
| InChIKey | JHYYSEGTZADVER-OPMOUVDSSA-N |
| XLogP | 1.53 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |