C23H25Cl2N3O8 — CID 145438618
1-[(3,4-dichlorophenyl)methyl]-6-methoxy-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indazole-3-carboxamide (PubChem CID 145438618) has the molecular formula C23H25Cl2N3O8 and a molecular weight of 542.37 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-6-methoxy-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indazole-3-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-6-methoxy-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 145438618 |
| Molecular Formula | C23H25Cl2N3O8 |
| Molecular Weight | 542.37 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-6-methoxy-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indazole-3-carboxamide |
| SMILES | COc1ccc2c(C(=O)N[C@@]3(CO)C(O)O[C@H](CO)[C@@H](O)[C@@H]3O)nn(Cc3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C23H25Cl2N3O8/c1-35-12-3-4-13-16(7-12)28(8-11-2-5-14(24)15(25)6-11)27-18(13)21(33)26-23(10-30)20(32)19(31)17(9-29)36-22(23)34/h2-7,17,19-20,22,29-32,34H,8-10H2,1H3,(H,26,33)/t17-,19-,20+,22?,23-/m1/s1 |
| InChIKey | FPLHWINDVMHZLO-SLXGCCRWSA-N |
| XLogP | 0.29 |
| TPSA | 166.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |