C17H15BrN2O3 — CID 175654005
methyl 3-bromo-1-[(4-methoxyphenyl)methyl]indazole-6-carboxylate (PubChem CID 175654005) has the molecular formula C17H15BrN2O3 and a molecular weight of 375.22 g/mol. Its IUPAC name is methyl 3-bromo-1-[(4-methoxyphenyl)methyl]indazole-6-carboxylate.
| Compound Name | methyl 3-bromo-1-[(4-methoxyphenyl)methyl]indazole-6-carboxylate |
|---|---|
| PubChem CID | 175654005 |
| Molecular Formula | C17H15BrN2O3 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | methyl 3-bromo-1-[(4-methoxyphenyl)methyl]indazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(Br)nn(Cc3ccc(OC)cc3)c2c1 |
| InChI | InChI=1S/C17H15BrN2O3/c1-22-13-6-3-11(4-7-13)10-20-15-9-12(17(21)23-2)5-8-14(15)16(18)19-20/h3-9H,10H2,1-2H3 |
| InChIKey | ABYZGIXBCWPNMY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |