About methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate
methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate (PubChem CID 175951142) has the molecular formula C17H16BrN3O4
and a molecular weight of 406.24 g/mol. Its IUPAC name is methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate |
| PubChem CID | 175951142 |
| Molecular Formula | C17H16BrN3O4 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(Br)nn(C)c2c1.COC(=O)c1cccnc1 |
| InChI | InChI=1S/C10H9BrN2O2.C7H7NO2/c1-13-8-5-6(10(14)15-2)3-4-7(8)9(11)12-13;1-10-7(9)6-3-2-4-8-5-6/h3-5H,1-2H3;2-5H,1H3 |
| InChIKey | ALNYNVMJLXYEGM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate?
The IUPAC name of methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate (CID 175951142) is methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate.
What is the SMILES notation for methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate?
The canonical SMILES for methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate is COC(=O)c1ccc2c(Br)nn(C)c2c1.COC(=O)c1cccnc1.
What is the InChIKey of methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate?
The InChIKey is ALNYNVMJLXYEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O2.C7H7NO2/c1-13-8-5-6(10(14)15-2)3-4-7(8)9(11)12-13;1-10-7(9)6-3-2-4-8-5-6/h3-5H,1-2H3;2-5H,1H3.
What are the key properties of methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate?
methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate has a molecular weight of 406.24 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-1-methylindazole-6-carboxylate;methyl pyridine-3-carboxylate is sourced from PubChem (CID 175951142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).