C13H14N2O4 — CID 142606640
methyl 3-(1,3-dioxolan-2-yl)-1-methylindazole-6-carboxylate (PubChem CID 142606640) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 3-(1,3-dioxolan-2-yl)-1-methylindazole-6-carboxylate.
| Compound Name | methyl 3-(1,3-dioxolan-2-yl)-1-methylindazole-6-carboxylate |
|---|---|
| PubChem CID | 142606640 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 3-(1,3-dioxolan-2-yl)-1-methylindazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3OCCO3)nn(C)c2c1 |
| InChI | InChI=1S/C13H14N2O4/c1-15-10-7-8(12(16)17-2)3-4-9(10)11(14-15)13-18-5-6-19-13/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | SWXZQFYVLFVVOE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |