methyl 3-methyl-1,2-benzoxazole-6-carboxylate

C10H9NO3 — CID 22610095

IUPACmethyl 3-methyl-1,2-benzoxazole-6-carboxylate
SMILESCOC(=O)c1ccc2c(C)noc2c1
InChIInChI=1S/C10H9NO3/c1-6-8-4-3-7(10(12)13-2)5-9(8)14-11-6/h3-5H,1-2H3
InChIKeyVEOUYCMGDQTISB-UHFFFAOYSA-N
MW191.19 g/mol
LogP1.92
Rot. Bonds1

About methyl 3-methyl-1,2-benzoxazole-6-carboxylate

methyl 3-methyl-1,2-benzoxazole-6-carboxylate (PubChem CID 22610095) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is methyl 3-methyl-1,2-benzoxazole-6-carboxylate.

Molecular Properties

Compound Namemethyl 3-methyl-1,2-benzoxazole-6-carboxylate
PubChem CID22610095
Molecular FormulaC10H9NO3
Molecular Weight191.19 g/mol
Exact Mass191.06
IUPAC Namemethyl 3-methyl-1,2-benzoxazole-6-carboxylate
SMILESCOC(=O)c1ccc2c(C)noc2c1
InChIInChI=1S/C10H9NO3/c1-6-8-4-3-7(10(12)13-2)5-9(8)14-11-6/h3-5H,1-2H3
InChIKeyVEOUYCMGDQTISB-UHFFFAOYSA-N
XLogP1.92
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.19
LogP ≤ 51.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-methyl-1,2-benzoxazole-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-methyl-1,2-benzoxazole-6-carboxylate?
The IUPAC name of methyl 3-methyl-1,2-benzoxazole-6-carboxylate (CID 22610095) is methyl 3-methyl-1,2-benzoxazole-6-carboxylate.
What is the SMILES notation for methyl 3-methyl-1,2-benzoxazole-6-carboxylate?
The canonical SMILES for methyl 3-methyl-1,2-benzoxazole-6-carboxylate is COC(=O)c1ccc2c(C)noc2c1.
What is the InChIKey of methyl 3-methyl-1,2-benzoxazole-6-carboxylate?
The InChIKey is VEOUYCMGDQTISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c1-6-8-4-3-7(10(12)13-2)5-9(8)14-11-6/h3-5H,1-2H3.
What are the key properties of methyl 3-methyl-1,2-benzoxazole-6-carboxylate?
methyl 3-methyl-1,2-benzoxazole-6-carboxylate has a molecular weight of 191.19 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-1,2-benzoxazole-6-carboxylate is sourced from PubChem (CID 22610095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).