C13H12FNO2 — CID 67961184
methyl 4-fluoro-1,3-dimethylisoquinoline-7-carboxylate (PubChem CID 67961184) has the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. Its IUPAC name is methyl 4-fluoro-1,3-dimethylisoquinoline-7-carboxylate.
| Compound Name | methyl 4-fluoro-1,3-dimethylisoquinoline-7-carboxylate |
|---|---|
| PubChem CID | 67961184 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | methyl 4-fluoro-1,3-dimethylisoquinoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(F)c(C)nc(C)c2c1 |
| InChI | InChI=1S/C13H12FNO2/c1-7-11-6-9(13(16)17-3)4-5-10(11)12(14)8(2)15-7/h4-6H,1-3H3 |
| InChIKey | SUFOOAZLRVPGRK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |