C14H11NO3 — CID 121367808
methyl 1-methyl-[1]benzofuro[2,3-c]pyridine-7-carboxylate (PubChem CID 121367808) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 1-methyl-[1]benzofuro[2,3-c]pyridine-7-carboxylate.
| Compound Name | methyl 1-methyl-[1]benzofuro[2,3-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 121367808 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | methyl 1-methyl-[1]benzofuro[2,3-c]pyridine-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)oc1c(C)nccc12 |
| InChI | InChI=1S/C14H11NO3/c1-8-13-11(5-6-15-8)10-4-3-9(14(16)17-2)7-12(10)18-13/h3-7H,1-2H3 |
| InChIKey | PWEBNTAGKWTIDK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |