C15H11NO4 — CID 162519514
methyl 4-furo[3,2-c]pyridin-4-yl-3-hydroxybenzoate (PubChem CID 162519514) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl 4-furo[3,2-c]pyridin-4-yl-3-hydroxybenzoate.
| Compound Name | methyl 4-furo[3,2-c]pyridin-4-yl-3-hydroxybenzoate |
|---|---|
| PubChem CID | 162519514 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | methyl 4-furo[3,2-c]pyridin-4-yl-3-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(-c2nccc3occc23)c(O)c1 |
| InChI | InChI=1S/C15H11NO4/c1-19-15(18)9-2-3-10(12(17)8-9)14-11-5-7-20-13(11)4-6-16-14/h2-8,17H,1H3 |
| InChIKey | IRXGRBWGSXHEFY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |