C20H19FN2O3 — CID 162519654
3-fluoro-4-furo[3,2-c]pyridin-4-yl-N-(4-hydroxycyclohexyl)benzamide (PubChem CID 162519654) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is 3-fluoro-4-furo[3,2-c]pyridin-4-yl-N-(4-hydroxycyclohexyl)benzamide.
| Compound Name | 3-fluoro-4-furo[3,2-c]pyridin-4-yl-N-(4-hydroxycyclohexyl)benzamide |
|---|---|
| PubChem CID | 162519654 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-fluoro-4-furo[3,2-c]pyridin-4-yl-N-(4-hydroxycyclohexyl)benzamide |
| SMILES | O=C(NC1CCC(O)CC1)c1ccc(-c2nccc3occc23)c(F)c1 |
| InChI | InChI=1S/C20H19FN2O3/c21-17-11-12(20(25)23-13-2-4-14(24)5-3-13)1-6-15(17)19-16-8-10-26-18(16)7-9-22-19/h1,6-11,13-14,24H,2-5H2,(H,23,25) |
| InChIKey | QODFELZHGFAJSU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |