C23H24N2O3 — CID 162519561
4-furo[3,2-c]pyridin-4-yl-N-[4-(1-hydroxycyclopropyl)cyclohexyl]benzamide (PubChem CID 162519561) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-furo[3,2-c]pyridin-4-yl-N-[4-(1-hydroxycyclopropyl)cyclohexyl]benzamide.
| Compound Name | 4-furo[3,2-c]pyridin-4-yl-N-[4-(1-hydroxycyclopropyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 162519561 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 4-furo[3,2-c]pyridin-4-yl-N-[4-(1-hydroxycyclopropyl)cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(C2(O)CC2)CC1)c1ccc(-c2nccc3occc23)cc1 |
| InChI | InChI=1S/C23H24N2O3/c26-22(25-18-7-5-17(6-8-18)23(27)11-12-23)16-3-1-15(2-4-16)21-19-10-14-28-20(19)9-13-24-21/h1-4,9-10,13-14,17-18,27H,5-8,11-12H2,(H,25,26) |
| InChIKey | LXIYYQANCSBQGD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |