C21H20F2N2O2 — CID 166900588
N-[4-(difluoromethyl)cyclohexyl]-4-furo[3,2-c]pyridin-4-ylbenzamide (PubChem CID 166900588) has the molecular formula C21H20F2N2O2 and a molecular weight of 370.40 g/mol. Its IUPAC name is N-[4-(difluoromethyl)cyclohexyl]-4-furo[3,2-c]pyridin-4-ylbenzamide.
| Compound Name | N-[4-(difluoromethyl)cyclohexyl]-4-furo[3,2-c]pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 166900588 |
| Molecular Formula | C21H20F2N2O2 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[4-(difluoromethyl)cyclohexyl]-4-furo[3,2-c]pyridin-4-ylbenzamide |
| SMILES | O=C(NC1CCC(C(F)F)CC1)c1ccc(-c2nccc3occc23)cc1 |
| InChI | InChI=1S/C21H20F2N2O2/c22-20(23)14-5-7-16(8-6-14)25-21(26)15-3-1-13(2-4-15)19-17-10-12-27-18(17)9-11-24-19/h1-4,9-12,14,16,20H,5-8H2,(H,25,26) |
| InChIKey | UUOHVDJANBUYDH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |