C23H21N5O2 — CID 162519533
4-furo[3,2-c]pyridin-4-yl-N-(1-pyridazin-3-ylpiperidin-4-yl)benzamide (PubChem CID 162519533) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-furo[3,2-c]pyridin-4-yl-N-(1-pyridazin-3-ylpiperidin-4-yl)benzamide.
| Compound Name | 4-furo[3,2-c]pyridin-4-yl-N-(1-pyridazin-3-ylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 162519533 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-furo[3,2-c]pyridin-4-yl-N-(1-pyridazin-3-ylpiperidin-4-yl)benzamide |
| SMILES | O=C(NC1CCN(c2cccnn2)CC1)c1ccc(-c2nccc3occc23)cc1 |
| InChI | InChI=1S/C23H21N5O2/c29-23(26-18-8-13-28(14-9-18)21-2-1-11-25-27-21)17-5-3-16(4-6-17)22-19-10-15-30-20(19)7-12-24-22/h1-7,10-12,15,18H,8-9,13-14H2,(H,26,29) |
| InChIKey | JFFASSVYPGRYMJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |