C17H11Cl2NO2 — CID 67960992
methyl 1-(2,3-dichlorophenyl)isoquinoline-7-carboxylate (PubChem CID 67960992) has the molecular formula C17H11Cl2NO2 and a molecular weight of 332.19 g/mol. Its IUPAC name is methyl 1-(2,3-dichlorophenyl)isoquinoline-7-carboxylate.
| Compound Name | methyl 1-(2,3-dichlorophenyl)isoquinoline-7-carboxylate |
|---|---|
| PubChem CID | 67960992 |
| Molecular Formula | C17H11Cl2NO2 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | methyl 1-(2,3-dichlorophenyl)isoquinoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2ccnc(-c3cccc(Cl)c3Cl)c2c1 |
| InChI | InChI=1S/C17H11Cl2NO2/c1-22-17(21)11-6-5-10-7-8-20-16(13(10)9-11)12-3-2-4-14(18)15(12)19/h2-9H,1H3 |
| InChIKey | UYSJKZLQORMZOA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |