About 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid
8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid (PubChem CID 58553759) has the molecular formula C17H10Cl2O2
and a molecular weight of 317.17 g/mol. Its IUPAC name is 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid |
| PubChem CID | 58553759 |
| Molecular Formula | C17H10Cl2O2 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cccc(-c3cccc(Cl)c3Cl)c2c1 |
| InChI | InChI=1S/C17H10Cl2O2/c18-15-6-2-5-13(16(15)19)12-4-1-3-10-7-8-11(17(20)21)9-14(10)12/h1-9H,(H,20,21) |
| InChIKey | YYWGJLLAFQDUFE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid?
The IUPAC name of 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid (CID 58553759) is 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid.
What is the SMILES notation for 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid?
The canonical SMILES for 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid is O=C(O)c1ccc2cccc(-c3cccc(Cl)c3Cl)c2c1.
What is the InChIKey of 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid?
The InChIKey is YYWGJLLAFQDUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2O2/c18-15-6-2-5-13(16(15)19)12-4-1-3-10-7-8-11(17(20)21)9-14(10)12/h1-9H,(H,20,21).
What are the key properties of 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid?
8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid has a molecular weight of 317.17 g/mol, XLogP of 5.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid is sourced from PubChem (CID 58553759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).