8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid

C17H10Cl2O2 — CID 58553759

IUPAC8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid
SMILESO=C(O)c1ccc2cccc(-c3cccc(Cl)c3Cl)c2c1
InChIInChI=1S/C17H10Cl2O2/c18-15-6-2-5-13(16(15)19)12-4-1-3-10-7-8-11(17(20)21)9-14(10)12/h1-9H,(H,20,21)
InChIKeyYYWGJLLAFQDUFE-UHFFFAOYSA-N
MW317.17 g/mol
LogP5.51
Rot. Bonds2

About 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid

8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid (PubChem CID 58553759) has the molecular formula C17H10Cl2O2 and a molecular weight of 317.17 g/mol. Its IUPAC name is 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid.

Molecular Properties

Compound Name8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid
PubChem CID58553759
Molecular FormulaC17H10Cl2O2
Molecular Weight317.17 g/mol
Exact Mass316.01
IUPAC Name8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid
SMILESO=C(O)c1ccc2cccc(-c3cccc(Cl)c3Cl)c2c1
InChIInChI=1S/C17H10Cl2O2/c18-15-6-2-5-13(16(15)19)12-4-1-3-10-7-8-11(17(20)21)9-14(10)12/h1-9H,(H,20,21)
InChIKeyYYWGJLLAFQDUFE-UHFFFAOYSA-N
XLogP5.51
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500317.17
LogP ≤ 55.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid?
The IUPAC name of 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid (CID 58553759) is 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid.
What is the SMILES notation for 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid?
The canonical SMILES for 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid is O=C(O)c1ccc2cccc(-c3cccc(Cl)c3Cl)c2c1.
What is the InChIKey of 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid?
The InChIKey is YYWGJLLAFQDUFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2O2/c18-15-6-2-5-13(16(15)19)12-4-1-3-10-7-8-11(17(20)21)9-14(10)12/h1-9H,(H,20,21).
What are the key properties of 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid?
8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid has a molecular weight of 317.17 g/mol, XLogP of 5.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,3-dichlorophenyl)naphthalene-2-carboxylic acid is sourced from PubChem (CID 58553759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).