C17H12Cl2O3 — CID 58407555
4-(2,3-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid (PubChem CID 58407555) has the molecular formula C17H12Cl2O3 and a molecular weight of 335.19 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid.
| Compound Name | 4-(2,3-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid |
|---|---|
| PubChem CID | 58407555 |
| Molecular Formula | C17H12Cl2O3 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid |
| SMILES | CC1C=C(c2cccc(Cl)c2Cl)c2cc(C(=O)O)ccc2O1 |
| InChI | InChI=1S/C17H12Cl2O3/c1-9-7-12(11-3-2-4-14(18)16(11)19)13-8-10(17(20)21)5-6-15(13)22-9/h2-9H,1H3,(H,20,21) |
| InChIKey | PSVBWAYKJCKJJV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |