C17H12F2O3 — CID 58406680
4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid (PubChem CID 58406680) has the molecular formula C17H12F2O3 and a molecular weight of 302.28 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid.
| Compound Name | 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid |
|---|---|
| PubChem CID | 58406680 |
| Molecular Formula | C17H12F2O3 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid |
| SMILES | CC1C=C(c2ccc(F)c(F)c2)c2cc(C(=O)O)ccc2O1 |
| InChI | InChI=1S/C17H12F2O3/c1-9-6-12(10-2-4-14(18)15(19)8-10)13-7-11(17(20)21)3-5-16(13)22-9/h2-9H,1H3,(H,20,21) |
| InChIKey | QITCCCJFJJPECV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |