4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid

C17H12F2O3 — CID 58406680

IUPAC4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid
SMILESCC1C=C(c2ccc(F)c(F)c2)c2cc(C(=O)O)ccc2O1
InChIInChI=1S/C17H12F2O3/c1-9-6-12(10-2-4-14(18)15(19)8-10)13-7-11(17(20)21)3-5-16(13)22-9/h2-9H,1H3,(H,20,21)
InChIKeyQITCCCJFJJPECV-UHFFFAOYSA-N
MW302.28 g/mol
LogP3.88
Rot. Bonds2

About 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid

4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid (PubChem CID 58406680) has the molecular formula C17H12F2O3 and a molecular weight of 302.28 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid.

Molecular Properties

Compound Name4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid
PubChem CID58406680
Molecular FormulaC17H12F2O3
Molecular Weight302.28 g/mol
Exact Mass302.08
IUPAC Name4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid
SMILESCC1C=C(c2ccc(F)c(F)c2)c2cc(C(=O)O)ccc2O1
InChIInChI=1S/C17H12F2O3/c1-9-6-12(10-2-4-14(18)15(19)8-10)13-7-11(17(20)21)3-5-16(13)22-9/h2-9H,1H3,(H,20,21)
InChIKeyQITCCCJFJJPECV-UHFFFAOYSA-N
XLogP3.88
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.28
LogP ≤ 53.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid?
The IUPAC name of 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid (CID 58406680) is 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid.
What is the SMILES notation for 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid?
The canonical SMILES for 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid is CC1C=C(c2ccc(F)c(F)c2)c2cc(C(=O)O)ccc2O1.
What is the InChIKey of 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid?
The InChIKey is QITCCCJFJJPECV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F2O3/c1-9-6-12(10-2-4-14(18)15(19)8-10)13-7-11(17(20)21)3-5-16(13)22-9/h2-9H,1H3,(H,20,21).
What are the key properties of 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid?
4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid has a molecular weight of 302.28 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenyl)-2-methyl-2H-chromene-6-carboxylic acid is sourced from PubChem (CID 58406680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).