4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid

C17H12Cl2O3 — CID 58407461

IUPAC4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid
SMILESCC1C=C(c2c(Cl)cccc2Cl)c2cc(C(=O)O)ccc2O1
InChIInChI=1S/C17H12Cl2O3/c1-9-7-12(16-13(18)3-2-4-14(16)19)11-8-10(17(20)21)5-6-15(11)22-9/h2-9H,1H3,(H,20,21)
InChIKeyVZLIQMKFAPLYFN-UHFFFAOYSA-N
MW335.19 g/mol
LogP4.90
Rot. Bonds2

About 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid

4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid (PubChem CID 58407461) has the molecular formula C17H12Cl2O3 and a molecular weight of 335.19 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid.

Molecular Properties

Compound Name4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid
PubChem CID58407461
Molecular FormulaC17H12Cl2O3
Molecular Weight335.19 g/mol
Exact Mass334.02
IUPAC Name4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid
SMILESCC1C=C(c2c(Cl)cccc2Cl)c2cc(C(=O)O)ccc2O1
InChIInChI=1S/C17H12Cl2O3/c1-9-7-12(16-13(18)3-2-4-14(16)19)11-8-10(17(20)21)5-6-15(11)22-9/h2-9H,1H3,(H,20,21)
InChIKeyVZLIQMKFAPLYFN-UHFFFAOYSA-N
XLogP4.90
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.19
LogP ≤ 54.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid?
The IUPAC name of 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid (CID 58407461) is 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid.
What is the SMILES notation for 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid?
The canonical SMILES for 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid is CC1C=C(c2c(Cl)cccc2Cl)c2cc(C(=O)O)ccc2O1.
What is the InChIKey of 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid?
The InChIKey is VZLIQMKFAPLYFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2O3/c1-9-7-12(16-13(18)3-2-4-14(16)19)11-8-10(17(20)21)5-6-15(11)22-9/h2-9H,1H3,(H,20,21).
What are the key properties of 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid?
4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid has a molecular weight of 335.19 g/mol, XLogP of 4.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylic acid is sourced from PubChem (CID 58407461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).