C18H16F2O3 — CID 134391746
4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid (PubChem CID 134391746) has the molecular formula C18H16F2O3 and a molecular weight of 318.32 g/mol. Its IUPAC name is 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid.
| Compound Name | 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 134391746 |
| Molecular Formula | C18H16F2O3 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid |
| SMILES | O=C(O)c1ccc(OC2CCCC2)c(-c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C18H16F2O3/c19-15-7-5-11(10-16(15)20)14-9-12(18(21)22)6-8-17(14)23-13-3-1-2-4-13/h5-10,13H,1-4H2,(H,21,22) |
| InChIKey | MXXVGHMBRQAZQS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |