4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid

C18H16F2O3 — CID 134391746

IUPAC4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid
SMILESO=C(O)c1ccc(OC2CCCC2)c(-c2ccc(F)c(F)c2)c1
InChIInChI=1S/C18H16F2O3/c19-15-7-5-11(10-16(15)20)14-9-12(18(21)22)6-8-17(14)23-13-3-1-2-4-13/h5-10,13H,1-4H2,(H,21,22)
InChIKeyMXXVGHMBRQAZQS-UHFFFAOYSA-N
MW318.32 g/mol
LogP4.65
Rot. Bonds4

About 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid

4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid (PubChem CID 134391746) has the molecular formula C18H16F2O3 and a molecular weight of 318.32 g/mol. Its IUPAC name is 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid.

Molecular Properties

Compound Name4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid
PubChem CID134391746
Molecular FormulaC18H16F2O3
Molecular Weight318.32 g/mol
Exact Mass318.11
IUPAC Name4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid
SMILESO=C(O)c1ccc(OC2CCCC2)c(-c2ccc(F)c(F)c2)c1
InChIInChI=1S/C18H16F2O3/c19-15-7-5-11(10-16(15)20)14-9-12(18(21)22)6-8-17(14)23-13-3-1-2-4-13/h5-10,13H,1-4H2,(H,21,22)
InChIKeyMXXVGHMBRQAZQS-UHFFFAOYSA-N
XLogP4.65
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.32
LogP ≤ 54.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid?
The IUPAC name of 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid (CID 134391746) is 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid.
What is the SMILES notation for 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid?
The canonical SMILES for 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid is O=C(O)c1ccc(OC2CCCC2)c(-c2ccc(F)c(F)c2)c1.
What is the InChIKey of 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid?
The InChIKey is MXXVGHMBRQAZQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2O3/c19-15-7-5-11(10-16(15)20)14-9-12(18(21)22)6-8-17(14)23-13-3-1-2-4-13/h5-10,13H,1-4H2,(H,21,22).
What are the key properties of 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid?
4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid has a molecular weight of 318.32 g/mol, XLogP of 4.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyloxy-3-(3,4-difluorophenyl)benzoic acid is sourced from PubChem (CID 134391746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).