C20H21F2NO5 — CID 122623429
3-(3,4-difluorophenyl)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid (PubChem CID 122623429) has the molecular formula C20H21F2NO5 and a molecular weight of 393.39 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid.
| Compound Name | 3-(3,4-difluorophenyl)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 122623429 |
| Molecular Formula | C20H21F2NO5 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-(3,4-difluorophenyl)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(C(=O)O)cc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H21F2NO5/c1-20(2,3)28-19(26)23-8-9-27-17-7-5-13(18(24)25)10-14(17)12-4-6-15(21)16(22)11-12/h4-7,10-11H,8-9H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | SQUIIRYRDQWQPB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|