C23H26N4O5 — CID 123460036
4-methoxy-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]quinazolin-6-yl]benzoic acid (PubChem CID 123460036) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 4-methoxy-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]quinazolin-6-yl]benzoic acid.
| Compound Name | 4-methoxy-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]quinazolin-6-yl]benzoic acid |
|---|---|
| PubChem CID | 123460036 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 4-methoxy-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]quinazolin-6-yl]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1-c1ccc2nc(NCCNC(=O)OC(C)(C)C)ncc2c1 |
| InChI | InChI=1S/C23H26N4O5/c1-23(2,3)32-22(30)25-10-9-24-21-26-13-16-11-14(5-7-18(16)27-21)17-12-15(20(28)29)6-8-19(17)31-4/h5-8,11-13H,9-10H2,1-4H3,(H,25,30)(H,28,29)(H,24,26,27) |
| InChIKey | VIQWKESADBVJBF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|