C13H20N4O4 — CID 114518096
4-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylic acid (PubChem CID 114518096) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylic acid.
| Compound Name | 4-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 114518096 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(NCCNC(=O)OC(C)(C)C)ncc1C(=O)O |
| InChI | InChI=1S/C13H20N4O4/c1-8-9(10(18)19)7-16-11(17-8)14-5-6-15-12(20)21-13(2,3)4/h7H,5-6H2,1-4H3,(H,15,20)(H,18,19)(H,14,16,17) |
| InChIKey | GRRXQZZGJZYZKW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|