C14H22N4O2S — CID 103278679
tert-butyl N-[2-(7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-ylamino)ethyl]carbamate (PubChem CID 103278679) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is tert-butyl N-[2-(7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-ylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 103278679 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | tert-butyl N-[2-(7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-ylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ncc2c(n1)CCSC2 |
| InChI | InChI=1S/C14H22N4O2S/c1-14(2,3)20-13(19)16-6-5-15-12-17-8-10-9-21-7-4-11(10)18-12/h8H,4-7,9H2,1-3H3,(H,16,19)(H,15,17,18) |
| InChIKey | VQVXZIVJWSXRGF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|