C16H26N4O2 — CID 103278680
tert-butyl N-[2-[(4-cyclopentylpyrimidin-2-yl)amino]ethyl]carbamate (PubChem CID 103278680) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-cyclopentylpyrimidin-2-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-cyclopentylpyrimidin-2-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 103278680 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | tert-butyl N-[2-[(4-cyclopentylpyrimidin-2-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1nccc(C2CCCC2)n1 |
| InChI | InChI=1S/C16H26N4O2/c1-16(2,3)22-15(21)19-11-10-18-14-17-9-8-13(20-14)12-6-4-5-7-12/h8-9,12H,4-7,10-11H2,1-3H3,(H,19,21)(H,17,18,20) |
| InChIKey | KFXWYWOGROWDBG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|