C13H21N3O2 — CID 115695358
tert-butyl N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]carbamate (PubChem CID 115695358) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 115695358 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | tert-butyl N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]carbamate |
| SMILES | Cc1ccnc(NCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C13H21N3O2/c1-10-5-6-14-11(9-10)15-7-8-16-12(17)18-13(2,3)4/h5-6,9H,7-8H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | QTDLIRHBJFJGGE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|