C13H14F5N3O — CID 123620341
4,4,5,5,5-pentafluoro-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]pent-2-enamide (PubChem CID 123620341) has the molecular formula C13H14F5N3O and a molecular weight of 323.27 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]pent-2-enamide.
| Compound Name | 4,4,5,5,5-pentafluoro-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]pent-2-enamide |
|---|---|
| PubChem CID | 123620341 |
| Molecular Formula | C13H14F5N3O |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]pent-2-enamide |
| SMILES | Cc1ccnc(NCCNC(=O)C=CC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F5N3O/c1-9-3-5-19-10(8-9)20-6-7-21-11(22)2-4-12(14,15)13(16,17)18/h2-5,8H,6-7H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | FSAJVJFSDCDYKR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|