C16H16F6N4O5 — CID 160509885
(E)-4,4,4-trifluorobut-2-enoic acid;(E)-4,4,4-trifluoro-N-[2-[(4-methyl-5-nitro-2-pyridinyl)amino]ethyl]but-2-enamide (PubChem CID 160509885) has the molecular formula C16H16F6N4O5 and a molecular weight of 458.32 g/mol. Its IUPAC name is (E)-4,4,4-trifluorobut-2-enoic acid;(E)-4,4,4-trifluoro-N-[2-[(4-methyl-5-nitro-2-pyridinyl)amino]ethyl]but-2-enamide.
| Compound Name | (E)-4,4,4-trifluorobut-2-enoic acid;(E)-4,4,4-trifluoro-N-[2-[(4-methyl-5-nitro-2-pyridinyl)amino]ethyl]but-2-enamide |
|---|---|
| PubChem CID | 160509885 |
| Molecular Formula | C16H16F6N4O5 |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | (E)-4,4,4-trifluorobut-2-enoic acid;(E)-4,4,4-trifluoro-N-[2-[(4-methyl-5-nitro-2-pyridinyl)amino]ethyl]but-2-enamide |
| SMILES | Cc1cc(NCCNC(=O)/C=C/C(F)(F)F)ncc1[N+](=O)[O-].O=C(O)/C=C/C(F)(F)F |
| InChI | InChI=1S/C12H13F3N4O3.C4H3F3O2/c1-8-6-10(18-7-9(8)19(21)22)16-4-5-17-11(20)2-3-12(13,14)15;5-4(6,7)2-1-3(8)9/h2-3,6-7H,4-5H2,1H3,(H,16,18)(H,17,20);1-2H,(H,8,9)/b3-2+;2-1+ |
| InChIKey | QSXGZNBMUSFELR-NUMLHYQUSA-N |
| XLogP | 3.13 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|