C9H10F3N3O2 — CID 83267804
5-methyl-4-nitro-N-(3,3,3-trifluoropropyl)pyridin-2-amine (PubChem CID 83267804) has the molecular formula C9H10F3N3O2 and a molecular weight of 249.19 g/mol. Its IUPAC name is 5-methyl-4-nitro-N-(3,3,3-trifluoropropyl)pyridin-2-amine.
| Compound Name | 5-methyl-4-nitro-N-(3,3,3-trifluoropropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 83267804 |
| Molecular Formula | C9H10F3N3O2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 5-methyl-4-nitro-N-(3,3,3-trifluoropropyl)pyridin-2-amine |
| SMILES | Cc1cnc(NCCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10F3N3O2/c1-6-5-14-8(4-7(6)15(16)17)13-3-2-9(10,11)12/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | XEDZUQUSFHDYEF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|