C12H18N4O3 — CID 83268004
N-tert-butyl-2-[(5-methyl-4-nitro-2-pyridinyl)amino]acetamide (PubChem CID 83268004) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-tert-butyl-2-[(5-methyl-4-nitro-2-pyridinyl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[(5-methyl-4-nitro-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 83268004 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-tert-butyl-2-[(5-methyl-4-nitro-2-pyridinyl)amino]acetamide |
| SMILES | Cc1cnc(NCC(=O)NC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O3/c1-8-6-13-10(5-9(8)16(18)19)14-7-11(17)15-12(2,3)4/h5-6H,7H2,1-4H3,(H,13,14)(H,15,17) |
| InChIKey | LQDYLOVKTSGKIE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|