C13H21N3O3 — CID 107153110
4,4-dimethyl-1-[(5-methyl-4-nitro-2-pyridinyl)amino]pentan-2-ol (PubChem CID 107153110) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4,4-dimethyl-1-[(5-methyl-4-nitro-2-pyridinyl)amino]pentan-2-ol.
| Compound Name | 4,4-dimethyl-1-[(5-methyl-4-nitro-2-pyridinyl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 107153110 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4,4-dimethyl-1-[(5-methyl-4-nitro-2-pyridinyl)amino]pentan-2-ol |
| SMILES | Cc1cnc(NCC(O)CC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N3O3/c1-9-7-14-12(5-11(9)16(18)19)15-8-10(17)6-13(2,3)4/h5,7,10,17H,6,8H2,1-4H3,(H,14,15) |
| InChIKey | YPCKCQCUPPUYTE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|