C15H18Cl2N4O2S — CID 114083017
tert-butyl N-[2-[[4-(2,5-dichlorothiophen-3-yl)pyrimidin-2-yl]amino]ethyl]carbamate (PubChem CID 114083017) has the molecular formula C15H18Cl2N4O2S and a molecular weight of 389.31 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(2,5-dichlorothiophen-3-yl)pyrimidin-2-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(2,5-dichlorothiophen-3-yl)pyrimidin-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 114083017 |
| Molecular Formula | C15H18Cl2N4O2S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | tert-butyl N-[2-[[4-(2,5-dichlorothiophen-3-yl)pyrimidin-2-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1nccc(-c2cc(Cl)sc2Cl)n1 |
| InChI | InChI=1S/C15H18Cl2N4O2S/c1-15(2,3)23-14(22)20-7-6-19-13-18-5-4-10(21-13)9-8-11(16)24-12(9)17/h4-5,8H,6-7H2,1-3H3,(H,20,22)(H,18,19,21) |
| InChIKey | DKQKEOSPJJONPV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|