C13H20N4O4 — CID 135268117
methyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylate (PubChem CID 135268117) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is methyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | methyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135268117 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | methyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(NCCNC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C13H20N4O4/c1-13(2,3)21-12(19)15-6-5-14-11-16-7-9(8-17-11)10(18)20-4/h7-8H,5-6H2,1-4H3,(H,15,19)(H,14,16,17) |
| InChIKey | YHWWAZZZSRFTHJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|