C7H9N3O3 — CID 90980975
2-(methoxyamino)-4-methylpyrimidine-5-carboxylic acid (PubChem CID 90980975) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-(methoxyamino)-4-methylpyrimidine-5-carboxylic acid.
| Compound Name | 2-(methoxyamino)-4-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 90980975 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-(methoxyamino)-4-methylpyrimidine-5-carboxylic acid |
| SMILES | CONc1ncc(C(=O)O)c(C)n1 |
| InChI | InChI=1S/C7H9N3O3/c1-4-5(6(11)12)3-8-7(9-4)10-13-2/h3H,1-2H3,(H,11,12)(H,8,9,10) |
| InChIKey | YSZJWYUHMJGDEH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|