C29H37N5O4 — CID 123528758
tert-butyl N-[5-[[6-[5-(cyclopropylcarbamoyl)-2-methoxyphenyl]quinazolin-2-yl]amino]pentyl]carbamate (PubChem CID 123528758) has the molecular formula C29H37N5O4 and a molecular weight of 519.65 g/mol. Its IUPAC name is tert-butyl N-[5-[[6-[5-(cyclopropylcarbamoyl)-2-methoxyphenyl]quinazolin-2-yl]amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[[6-[5-(cyclopropylcarbamoyl)-2-methoxyphenyl]quinazolin-2-yl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 123528758 |
| Molecular Formula | C29H37N5O4 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | tert-butyl N-[5-[[6-[5-(cyclopropylcarbamoyl)-2-methoxyphenyl]quinazolin-2-yl]amino]pentyl]carbamate |
| SMILES | COc1ccc(C(=O)NC2CC2)cc1-c1ccc2nc(NCCCCCNC(=O)OC(C)(C)C)ncc2c1 |
| InChI | InChI=1S/C29H37N5O4/c1-29(2,3)38-28(36)31-15-7-5-6-14-30-27-32-18-21-16-19(8-12-24(21)34-27)23-17-20(9-13-25(23)37-4)26(35)33-22-10-11-22/h8-9,12-13,16-18,22H,5-7,10-11,14-15H2,1-4H3,(H,31,36)(H,33,35)(H,30,32,34) |
| InChIKey | FQLNHGGNVSHVTN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|