C27H33N5O2 — CID 58829888
N-cyclopentyl-4-methyl-3-[2-(2-morpholin-4-ylethylamino)quinazolin-6-yl]benzamide (PubChem CID 58829888) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-cyclopentyl-4-methyl-3-[2-(2-morpholin-4-ylethylamino)quinazolin-6-yl]benzamide.
| Compound Name | N-cyclopentyl-4-methyl-3-[2-(2-morpholin-4-ylethylamino)quinazolin-6-yl]benzamide |
|---|---|
| PubChem CID | 58829888 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | N-cyclopentyl-4-methyl-3-[2-(2-morpholin-4-ylethylamino)quinazolin-6-yl]benzamide |
| SMILES | Cc1ccc(C(=O)NC2CCCC2)cc1-c1ccc2nc(NCCN3CCOCC3)ncc2c1 |
| InChI | InChI=1S/C27H33N5O2/c1-19-6-7-21(26(33)30-23-4-2-3-5-23)17-24(19)20-8-9-25-22(16-20)18-29-27(31-25)28-10-11-32-12-14-34-15-13-32/h6-9,16-18,23H,2-5,10-15H2,1H3,(H,30,33)(H,28,29,31) |
| InChIKey | IIEXKQMNNUTWDT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |