C35H35NO3 — CID 134391732
4-cyclopentyloxy-N-(4-cyclopentyloxy-3-phenylphenyl)-3-phenylbenzamide (PubChem CID 134391732) has the molecular formula C35H35NO3 and a molecular weight of 517.67 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-(4-cyclopentyloxy-3-phenylphenyl)-3-phenylbenzamide.
| Compound Name | 4-cyclopentyloxy-N-(4-cyclopentyloxy-3-phenylphenyl)-3-phenylbenzamide |
|---|---|
| PubChem CID | 134391732 |
| Molecular Formula | C35H35NO3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 4-cyclopentyloxy-N-(4-cyclopentyloxy-3-phenylphenyl)-3-phenylbenzamide |
| SMILES | O=C(Nc1ccc(OC2CCCC2)c(-c2ccccc2)c1)c1ccc(OC2CCCC2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C35H35NO3/c37-35(27-19-21-33(38-29-15-7-8-16-29)31(23-27)25-11-3-1-4-12-25)36-28-20-22-34(39-30-17-9-10-18-30)32(24-28)26-13-5-2-6-14-26/h1-6,11-14,19-24,29-30H,7-10,15-18H2,(H,36,37) |
| InChIKey | NOHDAKOIOVYAAN-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |