C18H14Cl2O3 — CID 58407399
methyl 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylate (PubChem CID 58407399) has the molecular formula C18H14Cl2O3 and a molecular weight of 349.21 g/mol. Its IUPAC name is methyl 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylate.
| Compound Name | methyl 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylate |
|---|---|
| PubChem CID | 58407399 |
| Molecular Formula | C18H14Cl2O3 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | methyl 4-(2,6-dichlorophenyl)-2-methyl-2H-chromene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(c1c(Cl)cccc1Cl)=CC(C)O2 |
| InChI | InChI=1S/C18H14Cl2O3/c1-10-8-13(17-14(19)4-3-5-15(17)20)12-9-11(18(21)22-2)6-7-16(12)23-10/h3-10H,1-2H3 |
| InChIKey | INRQUFMIAGGPPH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |