methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate

C10H10O5S — CID 19354750

IUPACmethyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)S(=O)(=O)C(C)O2
InChIInChI=1S/C10H10O5S/c1-6-15-8-4-3-7(10(11)14-2)5-9(8)16(6,12)13/h3-6H,1-2H3
InChIKeyQVKAMGMPSMHIMS-UHFFFAOYSA-N
MW242.25 g/mol
LogP0.99
Rot. Bonds1

About methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate

methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate (PubChem CID 19354750) has the molecular formula C10H10O5S and a molecular weight of 242.25 g/mol. Its IUPAC name is methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate.

Molecular Properties

Compound Namemethyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate
PubChem CID19354750
Molecular FormulaC10H10O5S
Molecular Weight242.25 g/mol
Exact Mass242.02
IUPAC Namemethyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate
SMILESCOC(=O)c1ccc2c(c1)S(=O)(=O)C(C)O2
InChIInChI=1S/C10H10O5S/c1-6-15-8-4-3-7(10(11)14-2)5-9(8)16(6,12)13/h3-6H,1-2H3
InChIKeyQVKAMGMPSMHIMS-UHFFFAOYSA-N
XLogP0.99
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.25
LogP ≤ 50.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate?
The IUPAC name of methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate (CID 19354750) is methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate.
What is the SMILES notation for methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate?
The canonical SMILES for methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate is COC(=O)c1ccc2c(c1)S(=O)(=O)C(C)O2.
What is the InChIKey of methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate?
The InChIKey is QVKAMGMPSMHIMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5S/c1-6-15-8-4-3-7(10(11)14-2)5-9(8)16(6,12)13/h3-6H,1-2H3.
What are the key properties of methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate?
methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate has a molecular weight of 242.25 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-3,3-dioxo-1,3lambda6-benzoxathiole-5-carboxylate is sourced from PubChem (CID 19354750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).