C12H8Cl6O4 — CID 23332925
methyl 2,4-bis(trichloromethyl)-4H-1,3-benzodioxine-6-carboxylate (PubChem CID 23332925) has the molecular formula C12H8Cl6O4 and a molecular weight of 428.91 g/mol. Its IUPAC name is methyl 2,4-bis(trichloromethyl)-4H-1,3-benzodioxine-6-carboxylate.
| Compound Name | methyl 2,4-bis(trichloromethyl)-4H-1,3-benzodioxine-6-carboxylate |
|---|---|
| PubChem CID | 23332925 |
| Molecular Formula | C12H8Cl6O4 |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 425.86 |
| IUPAC Name | methyl 2,4-bis(trichloromethyl)-4H-1,3-benzodioxine-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(C(Cl)(Cl)Cl)OC(C(Cl)(Cl)Cl)O2 |
| InChI | InChI=1S/C12H8Cl6O4/c1-20-9(19)5-2-3-7-6(4-5)8(11(13,14)15)22-10(21-7)12(16,17)18/h2-4,8,10H,1H3 |
| InChIKey | WXXDGUDCZNXPMT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|