C10H5Cl7O4S — CID 23332966
2,4-bis(trichloromethyl)-4H-1,3-benzodioxine-6-sulfonyl chloride (PubChem CID 23332966) has the molecular formula C10H5Cl7O4S and a molecular weight of 469.38 g/mol. Its IUPAC name is 2,4-bis(trichloromethyl)-4H-1,3-benzodioxine-6-sulfonyl chloride.
| Compound Name | 2,4-bis(trichloromethyl)-4H-1,3-benzodioxine-6-sulfonyl chloride |
|---|---|
| PubChem CID | 23332966 |
| Molecular Formula | C10H5Cl7O4S |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 465.77 |
| IUPAC Name | 2,4-bis(trichloromethyl)-4H-1,3-benzodioxine-6-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc2c(c1)C(C(Cl)(Cl)Cl)OC(C(Cl)(Cl)Cl)O2 |
| InChI | InChI=1S/C10H5Cl7O4S/c11-9(12,13)7-5-3-4(22(17,18)19)1-2-6(5)20-8(21-7)10(14,15)16/h1-3,7-8H |
| InChIKey | HMIRJHQVSJRBPK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|