C10H10ClNO4S — CID 65367733
4-carbamoyl-3,4-dihydro-2H-chromene-6-sulfonyl chloride (PubChem CID 65367733) has the molecular formula C10H10ClNO4S and a molecular weight of 275.71 g/mol. Its IUPAC name is 4-carbamoyl-3,4-dihydro-2H-chromene-6-sulfonyl chloride.
| Compound Name | 4-carbamoyl-3,4-dihydro-2H-chromene-6-sulfonyl chloride |
|---|---|
| PubChem CID | 65367733 |
| Molecular Formula | C10H10ClNO4S |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 4-carbamoyl-3,4-dihydro-2H-chromene-6-sulfonyl chloride |
| SMILES | NC(=O)C1CCOc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C10H10ClNO4S/c11-17(14,15)6-1-2-9-8(5-6)7(10(12)13)3-4-16-9/h1-2,5,7H,3-4H2,(H2,12,13) |
| InChIKey | MSAIKAJTBUVOEA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |