C14H17NO5S — CID 65382512
cyclobutyl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 65382512) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is cyclobutyl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | cyclobutyl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 65382512 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | cyclobutyl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | NS(=O)(=O)c1ccc2c(c1)C(C(=O)OC1CCC1)CCO2 |
| InChI | InChI=1S/C14H17NO5S/c15-21(17,18)10-4-5-13-12(8-10)11(6-7-19-13)14(16)20-9-2-1-3-9/h4-5,8-9,11H,1-3,6-7H2,(H2,15,17,18) |
| InChIKey | BOVYJGVEZXSFEC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |