C13H15NO6S — CID 102608652
oxetan-3-yl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 102608652) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is oxetan-3-yl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | oxetan-3-yl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 102608652 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | oxetan-3-yl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | NS(=O)(=O)c1ccc2c(c1)C(C(=O)OC1COC1)CCO2 |
| InChI | InChI=1S/C13H15NO6S/c14-21(16,17)9-1-2-12-11(5-9)10(3-4-19-12)13(15)20-8-6-18-7-8/h1-2,5,8,10H,3-4,6-7H2,(H2,14,16,17) |
| InChIKey | FDNKUBUXAOBTOZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |