About 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride
4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride (PubChem CID 65368865) has the molecular formula C13H16ClNO4S
and a molecular weight of 317.79 g/mol. Its IUPAC name is 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride.
Molecular Properties
| Compound Name | 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride |
| PubChem CID | 65368865 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride |
| SMILES | CCCNC(=O)C1CCOc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C13H16ClNO4S/c1-2-6-15-13(16)10-5-7-19-12-4-3-9(8-11(10)12)20(14,17)18/h3-4,8,10H,2,5-7H2,1H3,(H,15,16) |
| InChIKey | RSZPTDFLGUXWJS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride?
The IUPAC name of 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride (CID 65368865) is 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride.
What is the SMILES notation for 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride?
The canonical SMILES for 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride is CCCNC(=O)C1CCOc2ccc(S(=O)(=O)Cl)cc21.
What is the InChIKey of 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride?
The InChIKey is RSZPTDFLGUXWJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO4S/c1-2-6-15-13(16)10-5-7-19-12-4-3-9(8-11(10)12)20(14,17)18/h3-4,8,10H,2,5-7H2,1H3,(H,15,16).
What are the key properties of 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride?
4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride has a molecular weight of 317.79 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(propylcarbamoyl)-3,4-dihydro-2H-chromene-6-sulfonyl chloride is sourced from PubChem (CID 65368865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).