C12H16N2O2 — CID 63710623
N-(2-aminoethyl)-3,4-dihydro-2H-chromene-4-carboxamide (PubChem CID 63710623) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-(2-aminoethyl)-3,4-dihydro-2H-chromene-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-3,4-dihydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 63710623 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-(2-aminoethyl)-3,4-dihydro-2H-chromene-4-carboxamide |
| SMILES | NCCNC(=O)C1CCOc2ccccc21 |
| InChI | InChI=1S/C12H16N2O2/c13-6-7-14-12(15)10-5-8-16-11-4-2-1-3-9(10)11/h1-4,10H,5-8,13H2,(H,14,15) |
| InChIKey | HSISHOGEGBLHOF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |