C17H18N2O2 — CID 63710270
N-[(4-aminophenyl)methyl]-3,4-dihydro-2H-chromene-4-carboxamide (PubChem CID 63710270) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-3,4-dihydro-2H-chromene-4-carboxamide.
| Compound Name | N-[(4-aminophenyl)methyl]-3,4-dihydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 63710270 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-3,4-dihydro-2H-chromene-4-carboxamide |
| SMILES | Nc1ccc(CNC(=O)C2CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C17H18N2O2/c18-13-7-5-12(6-8-13)11-19-17(20)15-9-10-21-16-4-2-1-3-14(15)16/h1-8,15H,9-11,18H2,(H,19,20) |
| InChIKey | SLGCRSIZFIQGDH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|